About (Z)-2-[1-(2,5-dihydro-1H-pyrrol-3-yl)ethenylsulfanyl]ethenamine
(Z)-2-[1-(2,5-dihydro-1H-pyrrol-3-yl)ethenylsulfanyl]ethenamine (PubChem CID 89045052) has the molecular formula C8H12N2S
and a molecular weight of 168.26 g/mol. Its IUPAC name is (Z)-2-[1-(2,5-dihydro-1H-pyrrol-3-yl)ethenylsulfanyl]ethenamine.
Molecular Properties
| Compound Name | (Z)-2-[1-(2,5-dihydro-1H-pyrrol-3-yl)ethenylsulfanyl]ethenamine |
| PubChem CID | 89045052 |
| Molecular Formula | C8H12N2S |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | (Z)-2-[1-(2,5-dihydro-1H-pyrrol-3-yl)ethenylsulfanyl]ethenamine |
| SMILES | C=C(S/C=C\N)C1=CCNC1 |
| InChI | InChI=1S/C8H12N2S/c1-7(11-5-3-9)8-2-4-10-6-8/h2-3,5,10H,1,4,6,9H2/b5-3- |
| InChIKey | MVSKPPLHZSUVFJ-HYXAFXHYSA-N |
| XLogP | 1.19 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (Z)-2-[1-(2,5-dihydro-1H-pyrrol-3-yl)ethenylsulfanyl]ethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-[1-(2,5-dihydro-1H-pyrrol-3-yl)ethenylsulfanyl]ethenamine?
The IUPAC name of (Z)-2-[1-(2,5-dihydro-1H-pyrrol-3-yl)ethenylsulfanyl]ethenamine (CID 89045052) is (Z)-2-[1-(2,5-dihydro-1H-pyrrol-3-yl)ethenylsulfanyl]ethenamine.
What is the SMILES notation for (Z)-2-[1-(2,5-dihydro-1H-pyrrol-3-yl)ethenylsulfanyl]ethenamine?
The canonical SMILES for (Z)-2-[1-(2,5-dihydro-1H-pyrrol-3-yl)ethenylsulfanyl]ethenamine is C=C(S/C=C\N)C1=CCNC1.
What is the InChIKey of (Z)-2-[1-(2,5-dihydro-1H-pyrrol-3-yl)ethenylsulfanyl]ethenamine?
The InChIKey is MVSKPPLHZSUVFJ-HYXAFXHYSA-N. The full InChI is InChI=1S/C8H12N2S/c1-7(11-5-3-9)8-2-4-10-6-8/h2-3,5,10H,1,4,6,9H2/b5-3-.
What are the key properties of (Z)-2-[1-(2,5-dihydro-1H-pyrrol-3-yl)ethenylsulfanyl]ethenamine?
(Z)-2-[1-(2,5-dihydro-1H-pyrrol-3-yl)ethenylsulfanyl]ethenamine has a molecular weight of 168.26 g/mol, XLogP of 1.19, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-[1-(2,5-dihydro-1H-pyrrol-3-yl)ethenylsulfanyl]ethenamine is sourced from PubChem (CID 89045052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).