About imidazo[1,2-b][1,2]oxazol-3-amine
imidazo[1,2-b][1,2]oxazol-3-amine (PubChem CID 89045216) has the molecular formula C5H5N3O
and a molecular weight of 123.11 g/mol. Its IUPAC name is imidazo[1,2-b][1,2]oxazol-3-amine.
Molecular Properties
| Compound Name | imidazo[1,2-b][1,2]oxazol-3-amine |
| PubChem CID | 89045216 |
| Molecular Formula | C5H5N3O |
| Molecular Weight | 123.11 g/mol |
| Exact Mass | 123.04 |
| IUPAC Name | imidazo[1,2-b][1,2]oxazol-3-amine |
| SMILES | Nc1cnc2ccon12 |
| InChI | InChI=1S/C5H5N3O/c6-4-3-7-5-1-2-9-8(4)5/h1-3H,6H2 |
| InChIKey | KWBVMXXCGYGFNK-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 56.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.11 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze imidazo[1,2-b][1,2]oxazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazo[1,2-b][1,2]oxazol-3-amine?
The IUPAC name of imidazo[1,2-b][1,2]oxazol-3-amine (CID 89045216) is imidazo[1,2-b][1,2]oxazol-3-amine.
What is the SMILES notation for imidazo[1,2-b][1,2]oxazol-3-amine?
The canonical SMILES for imidazo[1,2-b][1,2]oxazol-3-amine is Nc1cnc2ccon12.
What is the InChIKey of imidazo[1,2-b][1,2]oxazol-3-amine?
The InChIKey is KWBVMXXCGYGFNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N3O/c6-4-3-7-5-1-2-9-8(4)5/h1-3H,6H2.
What are the key properties of imidazo[1,2-b][1,2]oxazol-3-amine?
imidazo[1,2-b][1,2]oxazol-3-amine has a molecular weight of 123.11 g/mol, XLogP of 0.51, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for imidazo[1,2-b][1,2]oxazol-3-amine is sourced from PubChem (CID 89045216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).