C36H33F2NO12 — CID 89045403
methyl 2-[4-(2,7-difluoro-3,6-dihydroxy-9H-xanthen-9-yl)-2-[1-[2-(2-methoxy-2-oxoethoxy)phenoxy]ethoxy]-N-(2-methoxy-2-oxoethyl)anilino]acetate (PubChem CID 89045403) has the molecular formula C36H33F2NO12 and a molecular weight of 709.65 g/mol. Its IUPAC name is methyl 2-[4-(2,7-difluoro-3,6-dihydroxy-9H-xanthen-9-yl)-2-[1-[2-(2-methoxy-2-oxoethoxy)phenoxy]ethoxy]-N-(2-methoxy-2-oxoethyl)anilino]acetate.
| Compound Name | methyl 2-[4-(2,7-difluoro-3,6-dihydroxy-9H-xanthen-9-yl)-2-[1-[2-(2-methoxy-2-oxoethoxy)phenoxy]ethoxy]-N-(2-methoxy-2-oxoethyl)anilino]acetate |
|---|---|
| PubChem CID | 89045403 |
| Molecular Formula | C36H33F2NO12 |
| Molecular Weight | 709.65 g/mol |
| Exact Mass | 709.20 |
| IUPAC Name | methyl 2-[4-(2,7-difluoro-3,6-dihydroxy-9H-xanthen-9-yl)-2-[1-[2-(2-methoxy-2-oxoethoxy)phenoxy]ethoxy]-N-(2-methoxy-2-oxoethyl)anilino]acetate |
| SMILES | COC(=O)COc1ccccc1OC(C)Oc1cc(C2c3cc(F)c(O)cc3Oc3cc(O)c(F)cc32)ccc1N(CC(=O)OC)CC(=O)OC |
| InChI | InChI=1S/C36H33F2NO12/c1-19(49-29-8-6-5-7-28(29)48-18-35(44)47-4)50-32-11-20(9-10-25(32)39(16-33(42)45-2)17-34(43)46-3)36-21-12-23(37)26(40)14-30(21)51-31-15-27(41)24(38)13-22(31)36/h5-15,19,36,40-41H,16-18H2,1-4H3 |
| InChIKey | LSYVWKOHOBRBGK-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 159.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.65 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|