C18H16F6N2O3S — CID 89045508
N,N-dimethyl-5-[(2,3,6-trifluorophenyl)-(3,3,3-trifluoropropylsulfonyl)methyl]pyridine-2-carboxamide (PubChem CID 89045508) has the molecular formula C18H16F6N2O3S and a molecular weight of 454.39 g/mol. Its IUPAC name is N,N-dimethyl-5-[(2,3,6-trifluorophenyl)-(3,3,3-trifluoropropylsulfonyl)methyl]pyridine-2-carboxamide.
| Compound Name | N,N-dimethyl-5-[(2,3,6-trifluorophenyl)-(3,3,3-trifluoropropylsulfonyl)methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 89045508 |
| Molecular Formula | C18H16F6N2O3S |
| Molecular Weight | 454.39 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | N,N-dimethyl-5-[(2,3,6-trifluorophenyl)-(3,3,3-trifluoropropylsulfonyl)methyl]pyridine-2-carboxamide |
| SMILES | CN(C)C(=O)c1ccc(C(c2c(F)ccc(F)c2F)S(=O)(=O)CCC(F)(F)F)cn1 |
| InChI | InChI=1S/C18H16F6N2O3S/c1-26(2)17(27)13-6-3-10(9-25-13)16(30(28,29)8-7-18(22,23)24)14-11(19)4-5-12(20)15(14)21/h3-6,9,16H,7-8H2,1-2H3 |
| InChIKey | RXBXOASTWKPWTH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|