C27H36F2N4O3 — CID 89045714
tert-butyl 3-[4-[1-[[aminooxy-(1-ethyl-6,6-difluoro-5,7-dihydro-4H-indazol-3-yl)methylidene]amino]ethenyl]-2,6-dimethylphenyl]propanoate (PubChem CID 89045714) has the molecular formula C27H36F2N4O3 and a molecular weight of 502.61 g/mol. Its IUPAC name is tert-butyl 3-[4-[1-[[aminooxy-(1-ethyl-6,6-difluoro-5,7-dihydro-4H-indazol-3-yl)methylidene]amino]ethenyl]-2,6-dimethylphenyl]propanoate.
| Compound Name | tert-butyl 3-[4-[1-[[aminooxy-(1-ethyl-6,6-difluoro-5,7-dihydro-4H-indazol-3-yl)methylidene]amino]ethenyl]-2,6-dimethylphenyl]propanoate |
|---|---|
| PubChem CID | 89045714 |
| Molecular Formula | C27H36F2N4O3 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | tert-butyl 3-[4-[1-[[aminooxy-(1-ethyl-6,6-difluoro-5,7-dihydro-4H-indazol-3-yl)methylidene]amino]ethenyl]-2,6-dimethylphenyl]propanoate |
| SMILES | C=C(/N=C(/ON)c1nn(CC)c2c1CCC(F)(F)C2)c1cc(C)c(CCC(=O)OC(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C27H36F2N4O3/c1-8-33-22-15-27(28,29)12-11-21(22)24(32-33)25(36-30)31-18(4)19-13-16(2)20(17(3)14-19)9-10-23(34)35-26(5,6)7/h13-14H,4,8-12,15,30H2,1-3,5-7H3/b31-25+ |
| InChIKey | GFBMBSJGZZTZDD-QCKNELIISA-N |
| XLogP | 5.23 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|