C12H2F4N4 — CID 89046068
2-[4-(dicyanomethylidene)-2,3,5,6-tetrafluorocyclohexa-2,5-dien-1-yl]propanedinitrile (PubChem CID 89046068) has the molecular formula C12H2F4N4 and a molecular weight of 278.17 g/mol. Its IUPAC name is 2-[4-(dicyanomethylidene)-2,3,5,6-tetrafluorocyclohexa-2,5-dien-1-yl]propanedinitrile.
| Compound Name | 2-[4-(dicyanomethylidene)-2,3,5,6-tetrafluorocyclohexa-2,5-dien-1-yl]propanedinitrile |
|---|---|
| PubChem CID | 89046068 |
| Molecular Formula | C12H2F4N4 |
| Molecular Weight | 278.17 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | 2-[4-(dicyanomethylidene)-2,3,5,6-tetrafluorocyclohexa-2,5-dien-1-yl]propanedinitrile |
| SMILES | N#CC(C#N)=C1C(F)=C(F)C(C(C#N)C#N)C(F)=C1F |
| InChI | InChI=1S/C12H2F4N4/c13-9-7(5(1-17)2-18)10(14)12(16)8(11(9)15)6(3-19)4-20/h5,7H |
| InChIKey | AIJFGRBZSPUEOV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.17 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|