About 1-trimethylsilylnona-1,5-diyn-3-one
1-trimethylsilylnona-1,5-diyn-3-one (PubChem CID 89046646) has the molecular formula C12H18OSi
and a molecular weight of 206.36 g/mol. Its IUPAC name is 1-trimethylsilylnona-1,5-diyn-3-one.
Molecular Properties
| Compound Name | 1-trimethylsilylnona-1,5-diyn-3-one |
| PubChem CID | 89046646 |
| Molecular Formula | C12H18OSi |
| Molecular Weight | 206.36 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 1-trimethylsilylnona-1,5-diyn-3-one |
| SMILES | CCCC#CCC(=O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C12H18OSi/c1-5-6-7-8-9-12(13)10-11-14(2,3)4/h5-6,9H2,1-4H3 |
| InChIKey | BKQZAQYKJJLNFI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-trimethylsilylnona-1,5-diyn-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-trimethylsilylnona-1,5-diyn-3-one?
The IUPAC name of 1-trimethylsilylnona-1,5-diyn-3-one (CID 89046646) is 1-trimethylsilylnona-1,5-diyn-3-one.
What is the SMILES notation for 1-trimethylsilylnona-1,5-diyn-3-one?
The canonical SMILES for 1-trimethylsilylnona-1,5-diyn-3-one is CCCC#CCC(=O)C#C[Si](C)(C)C.
What is the InChIKey of 1-trimethylsilylnona-1,5-diyn-3-one?
The InChIKey is BKQZAQYKJJLNFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18OSi/c1-5-6-7-8-9-12(13)10-11-14(2,3)4/h5-6,9H2,1-4H3.
What are the key properties of 1-trimethylsilylnona-1,5-diyn-3-one?
1-trimethylsilylnona-1,5-diyn-3-one has a molecular weight of 206.36 g/mol, XLogP of 2.63, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-trimethylsilylnona-1,5-diyn-3-one is sourced from PubChem (CID 89046646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).