C11H10N2O3S — CID 89046657
5-(6-hydroxy-2,3-dihydro-1H-indol-3-yl)-1,3-thiazolidine-2,4-dione (PubChem CID 89046657) has the molecular formula C11H10N2O3S and a molecular weight of 250.28 g/mol. Its IUPAC name is 5-(6-hydroxy-2,3-dihydro-1H-indol-3-yl)-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-(6-hydroxy-2,3-dihydro-1H-indol-3-yl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 89046657 |
| Molecular Formula | C11H10N2O3S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 5-(6-hydroxy-2,3-dihydro-1H-indol-3-yl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(C2CNc3cc(O)ccc32)S1 |
| InChI | InChI=1S/C11H10N2O3S/c14-5-1-2-6-7(4-12-8(6)3-5)9-10(15)13-11(16)17-9/h1-3,7,9,12,14H,4H2,(H,13,15,16) |
| InChIKey | LRFXIDPMQZTCLT-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|