C13H24O5 — CID 89046684
(2R,3S)-2-[[(4R,5R)-2,2-dimethyl-5-propan-2-yl-1,3-dioxolan-4-yl]oxy]pent-4-ene-1,3-diol (PubChem CID 89046684) has the molecular formula C13H24O5 and a molecular weight of 260.33 g/mol. Its IUPAC name is (2R,3S)-2-[[(4R,5R)-2,2-dimethyl-5-propan-2-yl-1,3-dioxolan-4-yl]oxy]pent-4-ene-1,3-diol.
| Compound Name | (2R,3S)-2-[[(4R,5R)-2,2-dimethyl-5-propan-2-yl-1,3-dioxolan-4-yl]oxy]pent-4-ene-1,3-diol |
|---|---|
| PubChem CID | 89046684 |
| Molecular Formula | C13H24O5 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | (2R,3S)-2-[[(4R,5R)-2,2-dimethyl-5-propan-2-yl-1,3-dioxolan-4-yl]oxy]pent-4-ene-1,3-diol |
| SMILES | C=C[C@H](O)[C@@H](CO)O[C@@H]1OC(C)(C)O[C@@H]1C(C)C |
| InChI | InChI=1S/C13H24O5/c1-6-9(15)10(7-14)16-12-11(8(2)3)17-13(4,5)18-12/h6,8-12,14-15H,1,7H2,2-5H3/t9-,10+,11+,12+/m0/s1 |
| InChIKey | SOLZQEQGTUCPFZ-IRCOFANPSA-N |
| XLogP | 1.04 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|