C18H22N4O5 — CID 89046730
methyl 2-[4-(2,2-dimethoxyethylamino)-2-[(4-nitrosophenyl)methyl]pyrimidin-5-yl]acetate (PubChem CID 89046730) has the molecular formula C18H22N4O5 and a molecular weight of 374.40 g/mol. Its IUPAC name is methyl 2-[4-(2,2-dimethoxyethylamino)-2-[(4-nitrosophenyl)methyl]pyrimidin-5-yl]acetate.
| Compound Name | methyl 2-[4-(2,2-dimethoxyethylamino)-2-[(4-nitrosophenyl)methyl]pyrimidin-5-yl]acetate |
|---|---|
| PubChem CID | 89046730 |
| Molecular Formula | C18H22N4O5 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | methyl 2-[4-(2,2-dimethoxyethylamino)-2-[(4-nitrosophenyl)methyl]pyrimidin-5-yl]acetate |
| SMILES | COC(=O)Cc1cnc(Cc2ccc(N=O)cc2)nc1NCC(OC)OC |
| InChI | InChI=1S/C18H22N4O5/c1-25-16(23)9-13-10-19-15(8-12-4-6-14(22-24)7-5-12)21-18(13)20-11-17(26-2)27-3/h4-7,10,17H,8-9,11H2,1-3H3,(H,19,20,21) |
| InChIKey | RINCMWQIFQXCIP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 112.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|