C15H20INOS — CID 89046873
(1E,3S,5E)-1-(2-ethyl-1,3-thiazol-4-yl)-6-iodo-2-methylnona-1,5,8-trien-3-ol (PubChem CID 89046873) has the molecular formula C15H20INOS and a molecular weight of 389.30 g/mol. Its IUPAC name is (1E,3S,5E)-1-(2-ethyl-1,3-thiazol-4-yl)-6-iodo-2-methylnona-1,5,8-trien-3-ol.
| Compound Name | (1E,3S,5E)-1-(2-ethyl-1,3-thiazol-4-yl)-6-iodo-2-methylnona-1,5,8-trien-3-ol |
|---|---|
| PubChem CID | 89046873 |
| Molecular Formula | C15H20INOS |
| Molecular Weight | 389.30 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | (1E,3S,5E)-1-(2-ethyl-1,3-thiazol-4-yl)-6-iodo-2-methylnona-1,5,8-trien-3-ol |
| SMILES | C=CC/C(I)=C\C[C@H](O)/C(C)=C/c1csc(CC)n1 |
| InChI | InChI=1S/C15H20INOS/c1-4-6-12(16)7-8-14(18)11(3)9-13-10-19-15(5-2)17-13/h4,7,9-10,14,18H,1,5-6,8H2,2-3H3/b11-9+,12-7+/t14-/m0/s1 |
| InChIKey | JHYRCWWUPWZLIO-WRYMYNDYSA-N |
| XLogP | 4.75 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.30 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|