C10H15F — CID 89047023
(3Z,5E)-2-fluoro-3,6-dimethylocta-1,3,5-triene (PubChem CID 89047023) has the molecular formula C10H15F and a molecular weight of 154.23 g/mol. Its IUPAC name is (3Z,5E)-2-fluoro-3,6-dimethylocta-1,3,5-triene.
| Compound Name | (3Z,5E)-2-fluoro-3,6-dimethylocta-1,3,5-triene |
|---|---|
| PubChem CID | 89047023 |
| Molecular Formula | C10H15F |
| Molecular Weight | 154.23 g/mol |
| Exact Mass | 154.12 |
| IUPAC Name | (3Z,5E)-2-fluoro-3,6-dimethylocta-1,3,5-triene |
| SMILES | C=C(F)/C(C)=C\C=C(/C)CC |
| InChI | InChI=1S/C10H15F/c1-5-8(2)6-7-9(3)10(4)11/h6-7H,4-5H2,1-3H3/b8-6+,9-7- |
| InChIKey | IHACYSADZUKGOP-FFELTBSMSA-N |
| XLogP | 3.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.23 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|