About cyclopropyl-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)methanone
cyclopropyl-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)methanone (PubChem CID 89047178) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is cyclopropyl-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)methanone.
Molecular Properties
| Compound Name | cyclopropyl-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)methanone |
| PubChem CID | 89047178 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | cyclopropyl-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)methanone |
| SMILES | CN1CC2CCC(C1)N2C(=O)C1CC1 |
| InChI | InChI=1S/C11H18N2O/c1-12-6-9-4-5-10(7-12)13(9)11(14)8-2-3-8/h8-10H,2-7H2,1H3 |
| InChIKey | HEHBGBSEAPTDQE-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopropyl-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropyl-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)methanone?
The IUPAC name of cyclopropyl-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)methanone (CID 89047178) is cyclopropyl-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)methanone.
What is the SMILES notation for cyclopropyl-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)methanone?
The canonical SMILES for cyclopropyl-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)methanone is CN1CC2CCC(C1)N2C(=O)C1CC1.
What is the InChIKey of cyclopropyl-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)methanone?
The InChIKey is HEHBGBSEAPTDQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O/c1-12-6-9-4-5-10(7-12)13(9)11(14)8-2-3-8/h8-10H,2-7H2,1H3.
What are the key properties of cyclopropyl-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)methanone?
cyclopropyl-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)methanone has a molecular weight of 194.28 g/mol, XLogP of 0.70, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyl-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)methanone is sourced from PubChem (CID 89047178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).