About 4-methyl-1,4-diazatricyclo[4.2.0.02,8]octane
4-methyl-1,4-diazatricyclo[4.2.0.02,8]octane (PubChem CID 89047572) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is 4-methyl-1,4-diazatricyclo[4.2.0.02,8]octane.
Molecular Properties
| Compound Name | 4-methyl-1,4-diazatricyclo[4.2.0.02,8]octane |
| PubChem CID | 89047572 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 4-methyl-1,4-diazatricyclo[4.2.0.02,8]octane |
| SMILES | CN1CC2CC3C(C1)N23 |
| InChI | InChI=1S/C7H12N2/c1-8-3-5-2-6-7(4-8)9(5)6/h5-7H,2-4H2,1H3 |
| InChIKey | BNEMRBQEXOVMQK-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-1,4-diazatricyclo[4.2.0.02,8]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1,4-diazatricyclo[4.2.0.02,8]octane?
The IUPAC name of 4-methyl-1,4-diazatricyclo[4.2.0.02,8]octane (CID 89047572) is 4-methyl-1,4-diazatricyclo[4.2.0.02,8]octane.
What is the SMILES notation for 4-methyl-1,4-diazatricyclo[4.2.0.02,8]octane?
The canonical SMILES for 4-methyl-1,4-diazatricyclo[4.2.0.02,8]octane is CN1CC2CC3C(C1)N23.
What is the InChIKey of 4-methyl-1,4-diazatricyclo[4.2.0.02,8]octane?
The InChIKey is BNEMRBQEXOVMQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2/c1-8-3-5-2-6-7(4-8)9(5)6/h5-7H,2-4H2,1H3.
What are the key properties of 4-methyl-1,4-diazatricyclo[4.2.0.02,8]octane?
4-methyl-1,4-diazatricyclo[4.2.0.02,8]octane has a molecular weight of 124.19 g/mol, XLogP of -0.24, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,4-diazatricyclo[4.2.0.02,8]octane is sourced from PubChem (CID 89047572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).