C22H34F4O4S — CID 89047786
2,3,4,5-tetrafluoro-6-(2-hexyldecoxy)benzenesulfonic acid (PubChem CID 89047786) has the molecular formula C22H34F4O4S and a molecular weight of 470.57 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-6-(2-hexyldecoxy)benzenesulfonic acid.
| Compound Name | 2,3,4,5-tetrafluoro-6-(2-hexyldecoxy)benzenesulfonic acid |
|---|---|
| PubChem CID | 89047786 |
| Molecular Formula | C22H34F4O4S |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | 2,3,4,5-tetrafluoro-6-(2-hexyldecoxy)benzenesulfonic acid |
| SMILES | CCCCCCCCC(CCCCCC)COc1c(F)c(F)c(F)c(F)c1S(=O)(=O)O |
| InChI | InChI=1S/C22H34F4O4S/c1-3-5-7-9-10-12-14-16(13-11-8-6-4-2)15-30-21-19(25)17(23)18(24)20(26)22(21)31(27,28)29/h16H,3-15H2,1-2H3,(H,27,28,29) |
| InChIKey | LGZPLAYQZLPSJT-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|