C16H22F3N5O3 — CID 89048476
2,2,2-trifluoro-N-[3-(8-methyl-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl]acetamide (PubChem CID 89048476) has the molecular formula C16H22F3N5O3 and a molecular weight of 389.38 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[3-(8-methyl-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[3-(8-methyl-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 89048476 |
| Molecular Formula | C16H22F3N5O3 |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 2,2,2-trifluoro-N-[3-(8-methyl-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl]acetamide |
| SMILES | CCCCCn1c(=O)n(CCCNC(=O)C(F)(F)F)c(=O)c2[nH]c(C)nc21 |
| InChI | InChI=1S/C16H22F3N5O3/c1-3-4-5-8-23-12-11(21-10(2)22-12)13(25)24(15(23)27)9-6-7-20-14(26)16(17,18)19/h3-9H2,1-2H3,(H,20,26)(H,21,22) |
| InChIKey | WNDWIRAWJBBJTB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|