About methyl 6-aminocyclohexa-1,3,4-triene-1-carboxylate
methyl 6-aminocyclohexa-1,3,4-triene-1-carboxylate (PubChem CID 89048553) has the molecular formula C8H9NO2
and a molecular weight of 151.16 g/mol. Its IUPAC name is methyl 6-aminocyclohexa-1,3,4-triene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 6-aminocyclohexa-1,3,4-triene-1-carboxylate |
| PubChem CID | 89048553 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | methyl 6-aminocyclohexa-1,3,4-triene-1-carboxylate |
| SMILES | COC(=O)C1=CC=C=CC1N |
| InChI | InChI=1S/C8H9NO2/c1-11-8(10)6-4-2-3-5-7(6)9/h2,4-5,7H,9H2,1H3 |
| InChIKey | HIGMKGPNPXTQID-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 6-aminocyclohexa-1,3,4-triene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-aminocyclohexa-1,3,4-triene-1-carboxylate?
The IUPAC name of methyl 6-aminocyclohexa-1,3,4-triene-1-carboxylate (CID 89048553) is methyl 6-aminocyclohexa-1,3,4-triene-1-carboxylate.
What is the SMILES notation for methyl 6-aminocyclohexa-1,3,4-triene-1-carboxylate?
The canonical SMILES for methyl 6-aminocyclohexa-1,3,4-triene-1-carboxylate is COC(=O)C1=CC=C=CC1N.
What is the InChIKey of methyl 6-aminocyclohexa-1,3,4-triene-1-carboxylate?
The InChIKey is HIGMKGPNPXTQID-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2/c1-11-8(10)6-4-2-3-5-7(6)9/h2,4-5,7H,9H2,1H3.
What are the key properties of methyl 6-aminocyclohexa-1,3,4-triene-1-carboxylate?
methyl 6-aminocyclohexa-1,3,4-triene-1-carboxylate has a molecular weight of 151.16 g/mol, XLogP of 0.14, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-aminocyclohexa-1,3,4-triene-1-carboxylate is sourced from PubChem (CID 89048553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).