About 2-(fluoromethyl)-1,3-oxazole-4-carboxamide
2-(fluoromethyl)-1,3-oxazole-4-carboxamide (PubChem CID 89048684) has the molecular formula C5H5FN2O2
and a molecular weight of 144.10 g/mol. Its IUPAC name is 2-(fluoromethyl)-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-(fluoromethyl)-1,3-oxazole-4-carboxamide |
| PubChem CID | 89048684 |
| Molecular Formula | C5H5FN2O2 |
| Molecular Weight | 144.10 g/mol |
| Exact Mass | 144.03 |
| IUPAC Name | 2-(fluoromethyl)-1,3-oxazole-4-carboxamide |
| SMILES | NC(=O)c1coc(CF)n1 |
| InChI | InChI=1S/C5H5FN2O2/c6-1-4-8-3(2-10-4)5(7)9/h2H,1H2,(H2,7,9) |
| InChIKey | OOKMXQRHWCDAMV-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.10 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(fluoromethyl)-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(fluoromethyl)-1,3-oxazole-4-carboxamide?
The IUPAC name of 2-(fluoromethyl)-1,3-oxazole-4-carboxamide (CID 89048684) is 2-(fluoromethyl)-1,3-oxazole-4-carboxamide.
What is the SMILES notation for 2-(fluoromethyl)-1,3-oxazole-4-carboxamide?
The canonical SMILES for 2-(fluoromethyl)-1,3-oxazole-4-carboxamide is NC(=O)c1coc(CF)n1.
What is the InChIKey of 2-(fluoromethyl)-1,3-oxazole-4-carboxamide?
The InChIKey is OOKMXQRHWCDAMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5FN2O2/c6-1-4-8-3(2-10-4)5(7)9/h2H,1H2,(H2,7,9).
What are the key properties of 2-(fluoromethyl)-1,3-oxazole-4-carboxamide?
2-(fluoromethyl)-1,3-oxazole-4-carboxamide has a molecular weight of 144.10 g/mol, XLogP of 0.24, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(fluoromethyl)-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 89048684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).