C21H35N3O2 — CID 89049413
(2Z,3E,5Z)-2-ethylidene-N-[(1-methylpiperidin-4-yl)methyl]-4-(morpholin-4-ylmethyl)hepta-3,5-dienamide (PubChem CID 89049413) has the molecular formula C21H35N3O2 and a molecular weight of 361.53 g/mol. Its IUPAC name is (2Z,3E,5Z)-2-ethylidene-N-[(1-methylpiperidin-4-yl)methyl]-4-(morpholin-4-ylmethyl)hepta-3,5-dienamide.
| Compound Name | (2Z,3E,5Z)-2-ethylidene-N-[(1-methylpiperidin-4-yl)methyl]-4-(morpholin-4-ylmethyl)hepta-3,5-dienamide |
|---|---|
| PubChem CID | 89049413 |
| Molecular Formula | C21H35N3O2 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.27 |
| IUPAC Name | (2Z,3E,5Z)-2-ethylidene-N-[(1-methylpiperidin-4-yl)methyl]-4-(morpholin-4-ylmethyl)hepta-3,5-dienamide |
| SMILES | C/C=C\C(=C/C(=C/C)C(=O)NCC1CCN(C)CC1)CN1CCOCC1 |
| InChI | InChI=1S/C21H35N3O2/c1-4-6-19(17-24-11-13-26-14-12-24)15-20(5-2)21(25)22-16-18-7-9-23(3)10-8-18/h4-6,15,18H,7-14,16-17H2,1-3H3,(H,22,25)/b6-4-,19-15+,20-5- |
| InChIKey | RTMRBLSSZSQHGL-WOXZQOFISA-N |
| XLogP | 2.23 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|