C15H14BrCl2NO3S — CID 89049523
2-bromo-4-[(2,4-dichlorobenzoyl)-propan-2-ylamino]-2,3-dihydrothiophene-5-carboxylic acid (PubChem CID 89049523) has the molecular formula C15H14BrCl2NO3S and a molecular weight of 439.16 g/mol. Its IUPAC name is 2-bromo-4-[(2,4-dichlorobenzoyl)-propan-2-ylamino]-2,3-dihydrothiophene-5-carboxylic acid.
| Compound Name | 2-bromo-4-[(2,4-dichlorobenzoyl)-propan-2-ylamino]-2,3-dihydrothiophene-5-carboxylic acid |
|---|---|
| PubChem CID | 89049523 |
| Molecular Formula | C15H14BrCl2NO3S |
| Molecular Weight | 439.16 g/mol |
| Exact Mass | 436.93 |
| IUPAC Name | 2-bromo-4-[(2,4-dichlorobenzoyl)-propan-2-ylamino]-2,3-dihydrothiophene-5-carboxylic acid |
| SMILES | CC(C)N(C(=O)c1ccc(Cl)cc1Cl)C1=C(C(=O)O)SC(Br)C1 |
| InChI | InChI=1S/C15H14BrCl2NO3S/c1-7(2)19(11-6-12(16)23-13(11)15(21)22)14(20)9-4-3-8(17)5-10(9)18/h3-5,7,12H,6H2,1-2H3,(H,21,22) |
| InChIKey | ABBYBBDMMIOLRG-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.16 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|