About 5-fluoro-2,6-dimethylcyclohexa-1,3-diene
5-fluoro-2,6-dimethylcyclohexa-1,3-diene (PubChem CID 89049672) has the molecular formula C8H11F
and a molecular weight of 126.17 g/mol. Its IUPAC name is 5-fluoro-2,6-dimethylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 5-fluoro-2,6-dimethylcyclohexa-1,3-diene |
| PubChem CID | 89049672 |
| Molecular Formula | C8H11F |
| Molecular Weight | 126.17 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | 5-fluoro-2,6-dimethylcyclohexa-1,3-diene |
| SMILES | CC1=CC(C)C(F)C=C1 |
| InChI | InChI=1S/C8H11F/c1-6-3-4-8(9)7(2)5-6/h3-5,7-8H,1-2H3 |
| InChIKey | DJHLNEYMBHSDPM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.17 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5-fluoro-2,6-dimethylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2,6-dimethylcyclohexa-1,3-diene?
The IUPAC name of 5-fluoro-2,6-dimethylcyclohexa-1,3-diene (CID 89049672) is 5-fluoro-2,6-dimethylcyclohexa-1,3-diene.
What is the SMILES notation for 5-fluoro-2,6-dimethylcyclohexa-1,3-diene?
The canonical SMILES for 5-fluoro-2,6-dimethylcyclohexa-1,3-diene is CC1=CC(C)C(F)C=C1.
What is the InChIKey of 5-fluoro-2,6-dimethylcyclohexa-1,3-diene?
The InChIKey is DJHLNEYMBHSDPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F/c1-6-3-4-8(9)7(2)5-6/h3-5,7-8H,1-2H3.
What are the key properties of 5-fluoro-2,6-dimethylcyclohexa-1,3-diene?
5-fluoro-2,6-dimethylcyclohexa-1,3-diene has a molecular weight of 126.17 g/mol, XLogP of 2.48, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2,6-dimethylcyclohexa-1,3-diene is sourced from PubChem (CID 89049672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).