C10H17IN2 — CID 89049676
(3Z,5Z)-4-(2-iodoethyl)-N-methyl-6-(methylideneamino)hexa-3,5-dien-1-amine (PubChem CID 89049676) has the molecular formula C10H17IN2 and a molecular weight of 292.16 g/mol. Its IUPAC name is (3Z,5Z)-4-(2-iodoethyl)-N-methyl-6-(methylideneamino)hexa-3,5-dien-1-amine.
| Compound Name | (3Z,5Z)-4-(2-iodoethyl)-N-methyl-6-(methylideneamino)hexa-3,5-dien-1-amine |
|---|---|
| PubChem CID | 89049676 |
| Molecular Formula | C10H17IN2 |
| Molecular Weight | 292.16 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | (3Z,5Z)-4-(2-iodoethyl)-N-methyl-6-(methylideneamino)hexa-3,5-dien-1-amine |
| SMILES | C=N/C=C\C(=C/CCNC)CCI |
| InChI | InChI=1S/C10H17IN2/c1-12-8-3-4-10(5-7-11)6-9-13-2/h4,6,9,12H,2-3,5,7-8H2,1H3/b9-6-,10-4- |
| InChIKey | VLAQGXIPGAJFSL-TYOMPSNXSA-N |
| XLogP | 2.56 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.16 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|