C16H16F4O2 — CID 89049755
(4-ethynyl-2,3,5,6-tetrafluorophenyl)methyl 2,3,3-trimethylbutanoate (PubChem CID 89049755) has the molecular formula C16H16F4O2 and a molecular weight of 316.29 g/mol. Its IUPAC name is (4-ethynyl-2,3,5,6-tetrafluorophenyl)methyl 2,3,3-trimethylbutanoate.
| Compound Name | (4-ethynyl-2,3,5,6-tetrafluorophenyl)methyl 2,3,3-trimethylbutanoate |
|---|---|
| PubChem CID | 89049755 |
| Molecular Formula | C16H16F4O2 |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | (4-ethynyl-2,3,5,6-tetrafluorophenyl)methyl 2,3,3-trimethylbutanoate |
| SMILES | C#Cc1c(F)c(F)c(COC(=O)C(C)C(C)(C)C)c(F)c1F |
| InChI | InChI=1S/C16H16F4O2/c1-6-9-11(17)13(19)10(14(20)12(9)18)7-22-15(21)8(2)16(3,4)5/h1,8H,7H2,2-5H3 |
| InChIKey | IYNQMBKEZHBGIN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|