C24H39N3O3 — CID 89049764
2-[1-[(2E,4E)-5-(cyclohexylcarbamoyl)-6-(propylamino)hepta-2,4,6-trien-2-yl]piperidin-3-yl]acetic acid (PubChem CID 89049764) has the molecular formula C24H39N3O3 and a molecular weight of 417.59 g/mol. Its IUPAC name is 2-[1-[(2E,4E)-5-(cyclohexylcarbamoyl)-6-(propylamino)hepta-2,4,6-trien-2-yl]piperidin-3-yl]acetic acid.
| Compound Name | 2-[1-[(2E,4E)-5-(cyclohexylcarbamoyl)-6-(propylamino)hepta-2,4,6-trien-2-yl]piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 89049764 |
| Molecular Formula | C24H39N3O3 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.30 |
| IUPAC Name | 2-[1-[(2E,4E)-5-(cyclohexylcarbamoyl)-6-(propylamino)hepta-2,4,6-trien-2-yl]piperidin-3-yl]acetic acid |
| SMILES | C=C(NCCC)/C(=C\C=C(/C)N1CCCC(CC(=O)O)C1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C24H39N3O3/c1-4-14-25-19(3)22(24(30)26-21-10-6-5-7-11-21)13-12-18(2)27-15-8-9-20(17-27)16-23(28)29/h12-13,20-21,25H,3-11,14-17H2,1-2H3,(H,26,30)(H,28,29)/b18-12+,22-13+ |
| InChIKey | MTEYHUJGSMJKSO-NAOBDLHNSA-N |
| XLogP | 3.97 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|