C15H24N2 — CID 89049774
3-methylidene-1-[(2E,4Z)-5-propan-2-ylhepta-2,4,6-trien-2-yl]piperazine (PubChem CID 89049774) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 3-methylidene-1-[(2E,4Z)-5-propan-2-ylhepta-2,4,6-trien-2-yl]piperazine.
| Compound Name | 3-methylidene-1-[(2E,4Z)-5-propan-2-ylhepta-2,4,6-trien-2-yl]piperazine |
|---|---|
| PubChem CID | 89049774 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 3-methylidene-1-[(2E,4Z)-5-propan-2-ylhepta-2,4,6-trien-2-yl]piperazine |
| SMILES | C=C/C(=C\C=C(/C)N1CCNC(=C)C1)C(C)C |
| InChI | InChI=1S/C15H24N2/c1-6-15(12(2)3)8-7-14(5)17-10-9-16-13(4)11-17/h6-8,12,16H,1,4,9-11H2,2-3,5H3/b14-7+,15-8+ |
| InChIKey | LOWRKNFFZSVHED-IROCBMIISA-N |
| XLogP | 3.08 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|