C20H27ClN2O3 — CID 89049828
6-chloro-N-[(1R,6R)-1-hydroxy-6-tricyclo[5.3.1.03,9]undecanyl]-2-propoxypyridine-3-carboxamide (PubChem CID 89049828) has the molecular formula C20H27ClN2O3 and a molecular weight of 378.90 g/mol. Its IUPAC name is 6-chloro-N-[(1R,6R)-1-hydroxy-6-tricyclo[5.3.1.03,9]undecanyl]-2-propoxypyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[(1R,6R)-1-hydroxy-6-tricyclo[5.3.1.03,9]undecanyl]-2-propoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 89049828 |
| Molecular Formula | C20H27ClN2O3 |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 6-chloro-N-[(1R,6R)-1-hydroxy-6-tricyclo[5.3.1.03,9]undecanyl]-2-propoxypyridine-3-carboxamide |
| SMILES | CCCOc1nc(Cl)ccc1C(=O)N[C@@H]1CCC2C[C@@]3(O)CC2CC1C3 |
| InChI | InChI=1S/C20H27ClN2O3/c1-2-7-26-19-15(4-6-17(21)23-19)18(24)22-16-5-3-12-9-20(25)10-13(12)8-14(16)11-20/h4,6,12-14,16,25H,2-3,5,7-11H2,1H3,(H,22,24)/t12?,13?,14?,16-,20-/m1/s1 |
| InChIKey | XOHBGJLPGNGFSC-DBQHKAHDSA-N |
| XLogP | 3.58 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|