C16H26FNO2 — CID 89049865
(4E,6E)-7-fluoro-N-[2-(hydroxymethyl)cyclohexyl]-4-methylocta-4,6-dienamide (PubChem CID 89049865) has the molecular formula C16H26FNO2 and a molecular weight of 283.39 g/mol. Its IUPAC name is (4E,6E)-7-fluoro-N-[2-(hydroxymethyl)cyclohexyl]-4-methylocta-4,6-dienamide.
| Compound Name | (4E,6E)-7-fluoro-N-[2-(hydroxymethyl)cyclohexyl]-4-methylocta-4,6-dienamide |
|---|---|
| PubChem CID | 89049865 |
| Molecular Formula | C16H26FNO2 |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | (4E,6E)-7-fluoro-N-[2-(hydroxymethyl)cyclohexyl]-4-methylocta-4,6-dienamide |
| SMILES | C/C(F)=C\C=C(/C)CCC(=O)NC1CCCCC1CO |
| InChI | InChI=1S/C16H26FNO2/c1-12(7-9-13(2)17)8-10-16(20)18-15-6-4-3-5-14(15)11-19/h7,9,14-15,19H,3-6,8,10-11H2,1-2H3,(H,18,20)/b12-7+,13-9+ |
| InChIKey | CXYMBIFLRPJDSM-QYFNTBEASA-N |
| XLogP | 3.25 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|