C22H24ClFN4O2 — CID 89049869
5-chloro-N-[(2S)-3-(4-fluorophenyl)-1-oxo-1-piperidin-1-ylpropan-2-yl]-4,5-dihydro-1H-pyrrolo[2,3-c]pyridine-2-carboxamide (PubChem CID 89049869) has the molecular formula C22H24ClFN4O2 and a molecular weight of 430.91 g/mol. Its IUPAC name is 5-chloro-N-[(2S)-3-(4-fluorophenyl)-1-oxo-1-piperidin-1-ylpropan-2-yl]-4,5-dihydro-1H-pyrrolo[2,3-c]pyridine-2-carboxamide.
| Compound Name | 5-chloro-N-[(2S)-3-(4-fluorophenyl)-1-oxo-1-piperidin-1-ylpropan-2-yl]-4,5-dihydro-1H-pyrrolo[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 89049869 |
| Molecular Formula | C22H24ClFN4O2 |
| Molecular Weight | 430.91 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 5-chloro-N-[(2S)-3-(4-fluorophenyl)-1-oxo-1-piperidin-1-ylpropan-2-yl]-4,5-dihydro-1H-pyrrolo[2,3-c]pyridine-2-carboxamide |
| SMILES | O=C(N[C@@H](Cc1ccc(F)cc1)C(=O)N1CCCCC1)c1cc2c([nH]1)C=NC(Cl)C2 |
| InChI | InChI=1S/C22H24ClFN4O2/c23-20-12-15-11-17(26-19(15)13-25-20)21(29)27-18(10-14-4-6-16(24)7-5-14)22(30)28-8-2-1-3-9-28/h4-7,11,13,18,20,26H,1-3,8-10,12H2,(H,27,29)/t18-,20?/m0/s1 |
| InChIKey | LBINVHFSWTUXFV-LROBGIAVSA-N |
| XLogP | 3.05 |
| TPSA | 77.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.91 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|