C15H15NO6 — CID 89049953
(2S,3R,4S,4aR,11bR)-3,4-dihydroxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridine-2-carbaldehyde (PubChem CID 89049953) has the molecular formula C15H15NO6 and a molecular weight of 305.29 g/mol. Its IUPAC name is (2S,3R,4S,4aR,11bR)-3,4-dihydroxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridine-2-carbaldehyde.
| Compound Name | (2S,3R,4S,4aR,11bR)-3,4-dihydroxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridine-2-carbaldehyde |
|---|---|
| PubChem CID | 89049953 |
| Molecular Formula | C15H15NO6 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | (2S,3R,4S,4aR,11bR)-3,4-dihydroxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridine-2-carbaldehyde |
| SMILES | O=C[C@H]1C[C@@H]2c3cc4c(cc3C(=O)N[C@H]2[C@H](O)[C@@H]1O)OCO4 |
| InChI | InChI=1S/C15H15NO6/c17-4-6-1-8-7-2-10-11(22-5-21-10)3-9(7)15(20)16-12(8)14(19)13(6)18/h2-4,6,8,12-14,18-19H,1,5H2,(H,16,20)/t6-,8-,12-,13-,14+/m1/s1 |
| InChIKey | HTXWLGTZFKAGIQ-ZKEQDLJPSA-N |
| XLogP | -0.45 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|