C13H19N — CID 89050075
(4aR)-4a,5,6-trimethyl-5,6,7,8-tetrahydronaphthalen-2-imine (PubChem CID 89050075) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is (4aR)-4a,5,6-trimethyl-5,6,7,8-tetrahydronaphthalen-2-imine.
| Compound Name | (4aR)-4a,5,6-trimethyl-5,6,7,8-tetrahydronaphthalen-2-imine |
|---|---|
| PubChem CID | 89050075 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | (4aR)-4a,5,6-trimethyl-5,6,7,8-tetrahydronaphthalen-2-imine |
| SMILES | [H]/N=C1\C=C[C@@]2(C)C(=C1)CCC(C)C2C |
| InChI | InChI=1S/C13H19N/c1-9-4-5-11-8-12(14)6-7-13(11,3)10(9)2/h6-10,14H,4-5H2,1-3H3/b14-12+/t9?,10?,13-/m1/s1 |
| InChIKey | RFSLRFLCMLZHQT-CDOPDIORSA-N |
| XLogP | 3.57 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|