About CID 89050098
CID 89050098 (PubChem CID 89050098) has the molecular formula C6H8BNO
and a molecular weight of 120.95 g/mol.
Molecular Properties
| Compound Name | CID 89050098 |
| PubChem CID | 89050098 |
| Molecular Formula | C6H8BNO |
| Molecular Weight | 120.95 g/mol |
| Exact Mass | 121.07 |
| IUPAC Name | — |
| SMILES | [B]C(=C)/C(O)=C\C=C/N |
| InChI | InChI=1S/C6H8BNO/c1-5(7)6(9)3-2-4-8/h2-4,9H,1,8H2/b4-2-,6-3+ |
| InChIKey | RBAXXQBLCYFUGP-MDNDHVJUSA-N |
| XLogP | 0.58 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.95 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze CID 89050098 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89050098?
The IUPAC name of CID 89050098 (CID 89050098) is not available.
What is the SMILES notation for CID 89050098?
The canonical SMILES for CID 89050098 is [B]C(=C)/C(O)=C\C=C/N.
What is the InChIKey of CID 89050098?
The InChIKey is RBAXXQBLCYFUGP-MDNDHVJUSA-N. The full InChI is InChI=1S/C6H8BNO/c1-5(7)6(9)3-2-4-8/h2-4,9H,1,8H2/b4-2-,6-3+.
What are the key properties of CID 89050098?
CID 89050098 has a molecular weight of 120.95 g/mol, XLogP of 0.58, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89050098 is sourced from PubChem (CID 89050098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).