About (5Z,7Z)-5-(3-aminopropyl)-4-methylidenenona-5,7-dien-1-ol
(5Z,7Z)-5-(3-aminopropyl)-4-methylidenenona-5,7-dien-1-ol (PubChem CID 89050113) has the molecular formula C13H23NO
and a molecular weight of 209.33 g/mol. Its IUPAC name is (5Z,7Z)-5-(3-aminopropyl)-4-methylidenenona-5,7-dien-1-ol.
Molecular Properties
| Compound Name | (5Z,7Z)-5-(3-aminopropyl)-4-methylidenenona-5,7-dien-1-ol |
| PubChem CID | 89050113 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | (5Z,7Z)-5-(3-aminopropyl)-4-methylidenenona-5,7-dien-1-ol |
| SMILES | C=C(CCCO)/C(=C\C=C/C)CCCN |
| InChI | InChI=1S/C13H23NO/c1-3-4-8-13(9-5-10-14)12(2)7-6-11-15/h3-4,8,15H,2,5-7,9-11,14H2,1H3/b4-3-,13-8- |
| InChIKey | FYNVNDDQHMVEMW-XZSWCIGXSA-N |
| XLogP | 2.56 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (5Z,7Z)-5-(3-aminopropyl)-4-methylidenenona-5,7-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z,7Z)-5-(3-aminopropyl)-4-methylidenenona-5,7-dien-1-ol?
The IUPAC name of (5Z,7Z)-5-(3-aminopropyl)-4-methylidenenona-5,7-dien-1-ol (CID 89050113) is (5Z,7Z)-5-(3-aminopropyl)-4-methylidenenona-5,7-dien-1-ol.
What is the SMILES notation for (5Z,7Z)-5-(3-aminopropyl)-4-methylidenenona-5,7-dien-1-ol?
The canonical SMILES for (5Z,7Z)-5-(3-aminopropyl)-4-methylidenenona-5,7-dien-1-ol is C=C(CCCO)/C(=C\C=C/C)CCCN.
What is the InChIKey of (5Z,7Z)-5-(3-aminopropyl)-4-methylidenenona-5,7-dien-1-ol?
The InChIKey is FYNVNDDQHMVEMW-XZSWCIGXSA-N. The full InChI is InChI=1S/C13H23NO/c1-3-4-8-13(9-5-10-14)12(2)7-6-11-15/h3-4,8,15H,2,5-7,9-11,14H2,1H3/b4-3-,13-8-.
What are the key properties of (5Z,7Z)-5-(3-aminopropyl)-4-methylidenenona-5,7-dien-1-ol?
(5Z,7Z)-5-(3-aminopropyl)-4-methylidenenona-5,7-dien-1-ol has a molecular weight of 209.33 g/mol, XLogP of 2.56, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z,7Z)-5-(3-aminopropyl)-4-methylidenenona-5,7-dien-1-ol is sourced from PubChem (CID 89050113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).