C19H39N3 — CID 89050567
(E)-10-methanimidoyl-2,7,7,9,12-pentamethyltridec-4-ene-1,12-diamine (PubChem CID 89050567) has the molecular formula C19H39N3 and a molecular weight of 309.54 g/mol. Its IUPAC name is (E)-10-methanimidoyl-2,7,7,9,12-pentamethyltridec-4-ene-1,12-diamine.
| Compound Name | (E)-10-methanimidoyl-2,7,7,9,12-pentamethyltridec-4-ene-1,12-diamine |
|---|---|
| PubChem CID | 89050567 |
| Molecular Formula | C19H39N3 |
| Molecular Weight | 309.54 g/mol |
| Exact Mass | 309.31 |
| IUPAC Name | (E)-10-methanimidoyl-2,7,7,9,12-pentamethyltridec-4-ene-1,12-diamine |
| SMILES | [H]/N=C/C(CC(C)(C)N)C(C)CC(C)(C)C/C=C/CC(C)CN |
| InChI | InChI=1S/C19H39N3/c1-15(13-20)9-7-8-10-18(3,4)11-16(2)17(14-21)12-19(5,6)22/h7-8,14-17,21H,9-13,20,22H2,1-6H3/b8-7+,21-14+ |
| InChIKey | JKGGOQGAPLIOTJ-DBVLCOFHSA-N |
| XLogP | 4.36 |
| TPSA | 75.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.54 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|