C29H22Cl2N2O4 — CID 89050649
4-[[6-chloro-4-(1-hydroxyethenyl)-3,4-dihydro-2H-chromen-7-yl]oxy]-N-[4-(4-chlorophenyl)-2-pyridinyl]benzamide (PubChem CID 89050649) has the molecular formula C29H22Cl2N2O4 and a molecular weight of 533.41 g/mol. Its IUPAC name is 4-[[6-chloro-4-(1-hydroxyethenyl)-3,4-dihydro-2H-chromen-7-yl]oxy]-N-[4-(4-chlorophenyl)-2-pyridinyl]benzamide.
| Compound Name | 4-[[6-chloro-4-(1-hydroxyethenyl)-3,4-dihydro-2H-chromen-7-yl]oxy]-N-[4-(4-chlorophenyl)-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 89050649 |
| Molecular Formula | C29H22Cl2N2O4 |
| Molecular Weight | 533.41 g/mol |
| Exact Mass | 532.10 |
| IUPAC Name | 4-[[6-chloro-4-(1-hydroxyethenyl)-3,4-dihydro-2H-chromen-7-yl]oxy]-N-[4-(4-chlorophenyl)-2-pyridinyl]benzamide |
| SMILES | C=C(O)C1CCOc2cc(Oc3ccc(C(=O)Nc4cc(-c5ccc(Cl)cc5)ccn4)cc3)c(Cl)cc21 |
| InChI | InChI=1S/C29H22Cl2N2O4/c1-17(34)23-11-13-36-26-16-27(25(31)15-24(23)26)37-22-8-4-19(5-9-22)29(35)33-28-14-20(10-12-32-28)18-2-6-21(30)7-3-18/h2-10,12,14-16,23,34H,1,11,13H2,(H,32,33,35) |
| InChIKey | MZXGMQNHPGFTKX-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.41 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|