C13H13ClN4O2S2 — CID 89050764
7-[(5-chloro-2,3-dihydrothiophen-2-yl)sulfonyl]-3,6,8,9-tetrahydropyrazolo[3,4-c][2,7]naphthyridine (PubChem CID 89050764) has the molecular formula C13H13ClN4O2S2 and a molecular weight of 356.86 g/mol. Its IUPAC name is 7-[(5-chloro-2,3-dihydrothiophen-2-yl)sulfonyl]-3,6,8,9-tetrahydropyrazolo[3,4-c][2,7]naphthyridine.
| Compound Name | 7-[(5-chloro-2,3-dihydrothiophen-2-yl)sulfonyl]-3,6,8,9-tetrahydropyrazolo[3,4-c][2,7]naphthyridine |
|---|---|
| PubChem CID | 89050764 |
| Molecular Formula | C13H13ClN4O2S2 |
| Molecular Weight | 356.86 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | 7-[(5-chloro-2,3-dihydrothiophen-2-yl)sulfonyl]-3,6,8,9-tetrahydropyrazolo[3,4-c][2,7]naphthyridine |
| SMILES | O=S(=O)(C1CC=C(Cl)S1)N1CCc2c(cnc3[nH]ncc23)C1 |
| InChI | InChI=1S/C13H13ClN4O2S2/c14-11-1-2-12(21-11)22(19,20)18-4-3-9-8(7-18)5-15-13-10(9)6-16-17-13/h1,5-6,12H,2-4,7H2,(H,15,16,17) |
| InChIKey | PFRNQOKBPMQSLY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.86 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |