C14H14N8 — CID 89050922
4-methanimidoyl-7-(1H-pyrazolo[5,4-d]pyrimidin-4-yl)-6,8-dihydro-5H-2,7-naphthyridin-3-amine (PubChem CID 89050922) has the molecular formula C14H14N8 and a molecular weight of 294.32 g/mol. Its IUPAC name is 4-methanimidoyl-7-(1H-pyrazolo[5,4-d]pyrimidin-4-yl)-6,8-dihydro-5H-2,7-naphthyridin-3-amine.
| Compound Name | 4-methanimidoyl-7-(1H-pyrazolo[5,4-d]pyrimidin-4-yl)-6,8-dihydro-5H-2,7-naphthyridin-3-amine |
|---|---|
| PubChem CID | 89050922 |
| Molecular Formula | C14H14N8 |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 4-methanimidoyl-7-(1H-pyrazolo[5,4-d]pyrimidin-4-yl)-6,8-dihydro-5H-2,7-naphthyridin-3-amine |
| SMILES | [H]/N=C/c1c(N)ncc2c1CCN(c1ncnc3[nH]ncc13)C2 |
| InChI | InChI=1S/C14H14N8/c15-3-10-9-1-2-22(6-8(9)4-17-12(10)16)14-11-5-20-21-13(11)18-7-19-14/h3-5,7,15H,1-2,6H2,(H2,16,17)(H,18,19,20,21)/b15-3+ |
| InChIKey | JIZWTYUGVNZBTC-CRKCGEKBSA-N |
| XLogP | 0.89 |
| TPSA | 120.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|