About (5R)-2-fluoro-5,6-dimethyl-3-nitrocyclohepta-1,3-diene
(5R)-2-fluoro-5,6-dimethyl-3-nitrocyclohepta-1,3-diene (PubChem CID 89051039) has the molecular formula C9H12FNO2
and a molecular weight of 185.20 g/mol. Its IUPAC name is (5R)-2-fluoro-5,6-dimethyl-3-nitrocyclohepta-1,3-diene.
Molecular Properties
| Compound Name | (5R)-2-fluoro-5,6-dimethyl-3-nitrocyclohepta-1,3-diene |
| PubChem CID | 89051039 |
| Molecular Formula | C9H12FNO2 |
| Molecular Weight | 185.20 g/mol |
| Exact Mass | 185.09 |
| IUPAC Name | (5R)-2-fluoro-5,6-dimethyl-3-nitrocyclohepta-1,3-diene |
| SMILES | CC1CC=C(F)C([N+](=O)[O-])=C[C@@H]1C |
| InChI | InChI=1S/C9H12FNO2/c1-6-3-4-8(10)9(11(12)13)5-7(6)2/h4-7H,3H2,1-2H3/t6?,7-/m0/s1 |
| InChIKey | NOHDQHMNXYNFFF-MLWJPKLSSA-N |
| XLogP | 2.68 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.20 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (5R)-2-fluoro-5,6-dimethyl-3-nitrocyclohepta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-2-fluoro-5,6-dimethyl-3-nitrocyclohepta-1,3-diene?
The IUPAC name of (5R)-2-fluoro-5,6-dimethyl-3-nitrocyclohepta-1,3-diene (CID 89051039) is (5R)-2-fluoro-5,6-dimethyl-3-nitrocyclohepta-1,3-diene.
What is the SMILES notation for (5R)-2-fluoro-5,6-dimethyl-3-nitrocyclohepta-1,3-diene?
The canonical SMILES for (5R)-2-fluoro-5,6-dimethyl-3-nitrocyclohepta-1,3-diene is CC1CC=C(F)C([N+](=O)[O-])=C[C@@H]1C.
What is the InChIKey of (5R)-2-fluoro-5,6-dimethyl-3-nitrocyclohepta-1,3-diene?
The InChIKey is NOHDQHMNXYNFFF-MLWJPKLSSA-N. The full InChI is InChI=1S/C9H12FNO2/c1-6-3-4-8(10)9(11(12)13)5-7(6)2/h4-7H,3H2,1-2H3/t6?,7-/m0/s1.
What are the key properties of (5R)-2-fluoro-5,6-dimethyl-3-nitrocyclohepta-1,3-diene?
(5R)-2-fluoro-5,6-dimethyl-3-nitrocyclohepta-1,3-diene has a molecular weight of 185.20 g/mol, XLogP of 2.68, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-2-fluoro-5,6-dimethyl-3-nitrocyclohepta-1,3-diene is sourced from PubChem (CID 89051039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).