2-(3,3-difluoropyrrolidin-1-yl)acetic acid

C6H9F2NO2 — CID 89051258

IUPAC2-(3,3-difluoropyrrolidin-1-yl)acetic acid
SMILESO=C(O)CN1CCC(F)(F)C1
InChIInChI=1S/C6H9F2NO2/c7-6(8)1-2-9(4-6)3-5(10)11/h1-4H2,(H,10,11)
InChIKeyHPNWKUPLYXQOPZ-UHFFFAOYSA-N
MW165.14 g/mol
LogP0.41
Rot. Bonds2

About 2-(3,3-difluoropyrrolidin-1-yl)acetic acid

2-(3,3-difluoropyrrolidin-1-yl)acetic acid (PubChem CID 89051258) has the molecular formula C6H9F2NO2 and a molecular weight of 165.14 g/mol. Its IUPAC name is 2-(3,3-difluoropyrrolidin-1-yl)acetic acid.

Molecular Properties

Compound Name2-(3,3-difluoropyrrolidin-1-yl)acetic acid
PubChem CID89051258
Molecular FormulaC6H9F2NO2
Molecular Weight165.14 g/mol
Exact Mass165.06
IUPAC Name2-(3,3-difluoropyrrolidin-1-yl)acetic acid
SMILESO=C(O)CN1CCC(F)(F)C1
InChIInChI=1S/C6H9F2NO2/c7-6(8)1-2-9(4-6)3-5(10)11/h1-4H2,(H,10,11)
InChIKeyHPNWKUPLYXQOPZ-UHFFFAOYSA-N
XLogP0.41
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500165.14
LogP ≤ 50.41
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(3,3-difluoropyrrolidin-1-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,3-difluoropyrrolidin-1-yl)acetic acid?
The IUPAC name of 2-(3,3-difluoropyrrolidin-1-yl)acetic acid (CID 89051258) is 2-(3,3-difluoropyrrolidin-1-yl)acetic acid.
What is the SMILES notation for 2-(3,3-difluoropyrrolidin-1-yl)acetic acid?
The canonical SMILES for 2-(3,3-difluoropyrrolidin-1-yl)acetic acid is O=C(O)CN1CCC(F)(F)C1.
What is the InChIKey of 2-(3,3-difluoropyrrolidin-1-yl)acetic acid?
The InChIKey is HPNWKUPLYXQOPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9F2NO2/c7-6(8)1-2-9(4-6)3-5(10)11/h1-4H2,(H,10,11).
What are the key properties of 2-(3,3-difluoropyrrolidin-1-yl)acetic acid?
2-(3,3-difluoropyrrolidin-1-yl)acetic acid has a molecular weight of 165.14 g/mol, XLogP of 0.41, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-difluoropyrrolidin-1-yl)acetic acid is sourced from PubChem (CID 89051258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).