C43H43Cl2F3N4O5 — CID 89051312
CID 89051312 (PubChem CID 89051312) has the molecular formula C43H43Cl2F3N4O5 and a molecular weight of 823.74 g/mol.
| Compound Name | CID 89051312 |
|---|---|
| PubChem CID | 89051312 |
| Molecular Formula | C43H43Cl2F3N4O5 |
| Molecular Weight | 823.74 g/mol |
| Exact Mass | 822.26 |
| IUPAC Name | — |
| SMILES | C[C@@H](O)[C@@H]1CC[C@@H](NC(=O)[C@H]2[C@H](c3ccnc(Cl)c3F)C3(C(=O)Nc4cc(Cl)ccc43)C3(CC(CF)(CF)C3)N2[C@H](c2ccccc2)[C@@H](O)c2ccccc2)CO1 |
| InChI | InChI=1S/C43H43Cl2F3N4O5/c1-24(53)32-15-13-28(19-57-32)50-39(55)36-33(29-16-17-49-38(45)34(29)48)43(30-14-12-27(44)18-31(30)51-40(43)56)42(20-41(21-42,22-46)23-47)52(36)35(25-8-4-2-5-9-25)37(54)26-10-6-3-7-11-26/h2-12,14,16-18,24,28,32-33,35-37,53-54H,13,15,19-23H2,1H3,(H,50,55)(H,51,56)/t24-,28-,32+,33+,35-,36-,37+,43?/m1/s1 |
| InChIKey | GDMRNWKQIBQQDO-KCTGQNAFSA-N |
| XLogP | 7.16 |
| TPSA | 124.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.74 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|