About 2-[(2S,5R)-5-aminooxan-2-yl]ethanol
2-[(2S,5R)-5-aminooxan-2-yl]ethanol (PubChem CID 89051551) has the molecular formula C7H15NO2
and a molecular weight of 145.20 g/mol. Its IUPAC name is 2-[(2S,5R)-5-aminooxan-2-yl]ethanol.
Molecular Properties
| Compound Name | 2-[(2S,5R)-5-aminooxan-2-yl]ethanol |
| PubChem CID | 89051551 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | 2-[(2S,5R)-5-aminooxan-2-yl]ethanol |
| SMILES | N[C@@H]1CC[C@@H](CCO)OC1 |
| InChI | InChI=1S/C7H15NO2/c8-6-1-2-7(3-4-9)10-5-6/h6-7,9H,1-5,8H2/t6-,7+/m1/s1 |
| InChIKey | WZSZIBFPFKNJPR-RQJHMYQMSA-N |
| XLogP | -0.12 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(2S,5R)-5-aminooxan-2-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S,5R)-5-aminooxan-2-yl]ethanol?
The IUPAC name of 2-[(2S,5R)-5-aminooxan-2-yl]ethanol (CID 89051551) is 2-[(2S,5R)-5-aminooxan-2-yl]ethanol.
What is the SMILES notation for 2-[(2S,5R)-5-aminooxan-2-yl]ethanol?
The canonical SMILES for 2-[(2S,5R)-5-aminooxan-2-yl]ethanol is N[C@@H]1CC[C@@H](CCO)OC1.
What is the InChIKey of 2-[(2S,5R)-5-aminooxan-2-yl]ethanol?
The InChIKey is WZSZIBFPFKNJPR-RQJHMYQMSA-N. The full InChI is InChI=1S/C7H15NO2/c8-6-1-2-7(3-4-9)10-5-6/h6-7,9H,1-5,8H2/t6-,7+/m1/s1.
What are the key properties of 2-[(2S,5R)-5-aminooxan-2-yl]ethanol?
2-[(2S,5R)-5-aminooxan-2-yl]ethanol has a molecular weight of 145.20 g/mol, XLogP of -0.12, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S,5R)-5-aminooxan-2-yl]ethanol is sourced from PubChem (CID 89051551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).