C20H22F2N4O7S2 — CID 89051616
3-[[4-[4-[(E)-3-(diaminomethylideneamino)-2-methyl-3-oxoprop-1-enyl]-2,6-difluorophenoxy]phenyl]sulfonylamino]propane-1-sulfonic acid (PubChem CID 89051616) has the molecular formula C20H22F2N4O7S2 and a molecular weight of 532.55 g/mol. Its IUPAC name is 3-[[4-[4-[(E)-3-(diaminomethylideneamino)-2-methyl-3-oxoprop-1-enyl]-2,6-difluorophenoxy]phenyl]sulfonylamino]propane-1-sulfonic acid.
| Compound Name | 3-[[4-[4-[(E)-3-(diaminomethylideneamino)-2-methyl-3-oxoprop-1-enyl]-2,6-difluorophenoxy]phenyl]sulfonylamino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 89051616 |
| Molecular Formula | C20H22F2N4O7S2 |
| Molecular Weight | 532.55 g/mol |
| Exact Mass | 532.09 |
| IUPAC Name | 3-[[4-[4-[(E)-3-(diaminomethylideneamino)-2-methyl-3-oxoprop-1-enyl]-2,6-difluorophenoxy]phenyl]sulfonylamino]propane-1-sulfonic acid |
| SMILES | C/C(=C\c1cc(F)c(Oc2ccc(S(=O)(=O)NCCCS(=O)(=O)O)cc2)c(F)c1)C(=O)N=C(N)N |
| InChI | InChI=1S/C20H22F2N4O7S2/c1-12(19(27)26-20(23)24)9-13-10-16(21)18(17(22)11-13)33-14-3-5-15(6-4-14)35(31,32)25-7-2-8-34(28,29)30/h3-6,9-11,25H,2,7-8H2,1H3,(H,28,29,30)(H4,23,24,26,27)/b12-9+ |
| InChIKey | JQYGKXMOBSFUFW-FMIVXFBMSA-N |
| XLogP | 1.52 |
| TPSA | 191.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.55 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|