C21H23Cl2N3O — CID 89051674
N-[2-[3-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)anilino]ethyl]prop-2-enamide (PubChem CID 89051674) has the molecular formula C21H23Cl2N3O and a molecular weight of 404.34 g/mol. Its IUPAC name is N-[2-[3-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)anilino]ethyl]prop-2-enamide.
| Compound Name | N-[2-[3-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)anilino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 89051674 |
| Molecular Formula | C21H23Cl2N3O |
| Molecular Weight | 404.34 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | N-[2-[3-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)anilino]ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCNc1cccc(C2CN(C)Cc3c(Cl)cc(Cl)cc32)c1 |
| InChI | InChI=1S/C21H23Cl2N3O/c1-3-21(27)25-8-7-24-16-6-4-5-14(9-16)18-12-26(2)13-19-17(18)10-15(22)11-20(19)23/h3-6,9-11,18,24H,1,7-8,12-13H2,2H3,(H,25,27) |
| InChIKey | BDZCALWQKDATQW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.34 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|