About methyl 4-methylpentaneperoxoate
methyl 4-methylpentaneperoxoate (PubChem CID 89052097) has the molecular formula C7H14O3
and a molecular weight of 146.19 g/mol. Its IUPAC name is methyl 4-methylpentaneperoxoate.
Molecular Properties
| Compound Name | methyl 4-methylpentaneperoxoate |
| PubChem CID | 89052097 |
| Molecular Formula | C7H14O3 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | methyl 4-methylpentaneperoxoate |
| SMILES | COOC(=O)CCC(C)C |
| InChI | InChI=1S/C7H14O3/c1-6(2)4-5-7(8)10-9-3/h6H,4-5H2,1-3H3 |
| InChIKey | YMSQIKCMBATCKY-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-methylpentaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-methylpentaneperoxoate?
The IUPAC name of methyl 4-methylpentaneperoxoate (CID 89052097) is methyl 4-methylpentaneperoxoate.
What is the SMILES notation for methyl 4-methylpentaneperoxoate?
The canonical SMILES for methyl 4-methylpentaneperoxoate is COOC(=O)CCC(C)C.
What is the InChIKey of methyl 4-methylpentaneperoxoate?
The InChIKey is YMSQIKCMBATCKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O3/c1-6(2)4-5-7(8)10-9-3/h6H,4-5H2,1-3H3.
What are the key properties of methyl 4-methylpentaneperoxoate?
methyl 4-methylpentaneperoxoate has a molecular weight of 146.19 g/mol, XLogP of 1.53, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-methylpentaneperoxoate is sourced from PubChem (CID 89052097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).