5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-ylcarbamic acid

C7H8N2O2S — CID 89052113

IUPAC5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-ylcarbamic acid
SMILESO=C(O)Nc1nc2c(s1)CCC2
InChIInChI=1S/C7H8N2O2S/c10-7(11)9-6-8-4-2-1-3-5(4)12-6/h1-3H2,(H,8,9)(H,10,11)
InChIKeySDSBTALDWBSWND-UHFFFAOYSA-N
MW184.22 g/mol
LogP1.72
Rot. Bonds1

About 5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-ylcarbamic acid

5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-ylcarbamic acid (PubChem CID 89052113) has the molecular formula C7H8N2O2S and a molecular weight of 184.22 g/mol. Its IUPAC name is 5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-ylcarbamic acid.

Molecular Properties

Compound Name5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-ylcarbamic acid
PubChem CID89052113
Molecular FormulaC7H8N2O2S
Molecular Weight184.22 g/mol
Exact Mass184.03
IUPAC Name5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-ylcarbamic acid
SMILESO=C(O)Nc1nc2c(s1)CCC2
InChIInChI=1S/C7H8N2O2S/c10-7(11)9-6-8-4-2-1-3-5(4)12-6/h1-3H2,(H,8,9)(H,10,11)
InChIKeySDSBTALDWBSWND-UHFFFAOYSA-N
XLogP1.72
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.22
LogP ≤ 51.72
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-ylcarbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-ylcarbamic acid?
The IUPAC name of 5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-ylcarbamic acid (CID 89052113) is 5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-ylcarbamic acid.
What is the SMILES notation for 5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-ylcarbamic acid?
The canonical SMILES for 5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-ylcarbamic acid is O=C(O)Nc1nc2c(s1)CCC2.
What is the InChIKey of 5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-ylcarbamic acid?
The InChIKey is SDSBTALDWBSWND-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2S/c10-7(11)9-6-8-4-2-1-3-5(4)12-6/h1-3H2,(H,8,9)(H,10,11).
What are the key properties of 5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-ylcarbamic acid?
5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-ylcarbamic acid has a molecular weight of 184.22 g/mol, XLogP of 1.72, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-ylcarbamic acid is sourced from PubChem (CID 89052113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).