C28H48O5Si — CID 89052201
ethyl (2Z,4E)-3-ethyl-5-(2,3,7,9,9-pentamethyl-8-triethylsilyloxy-1,4-dioxaspiro[4.5]dec-6-en-8-yl)penta-2,4-dienoate (PubChem CID 89052201) has the molecular formula C28H48O5Si and a molecular weight of 492.77 g/mol. Its IUPAC name is ethyl (2Z,4E)-3-ethyl-5-(2,3,7,9,9-pentamethyl-8-triethylsilyloxy-1,4-dioxaspiro[4.5]dec-6-en-8-yl)penta-2,4-dienoate.
| Compound Name | ethyl (2Z,4E)-3-ethyl-5-(2,3,7,9,9-pentamethyl-8-triethylsilyloxy-1,4-dioxaspiro[4.5]dec-6-en-8-yl)penta-2,4-dienoate |
|---|---|
| PubChem CID | 89052201 |
| Molecular Formula | C28H48O5Si |
| Molecular Weight | 492.77 g/mol |
| Exact Mass | 492.33 |
| IUPAC Name | ethyl (2Z,4E)-3-ethyl-5-(2,3,7,9,9-pentamethyl-8-triethylsilyloxy-1,4-dioxaspiro[4.5]dec-6-en-8-yl)penta-2,4-dienoate |
| SMILES | CCOC(=O)/C=C(\C=C\C1(O[Si](CC)(CC)CC)C(C)=CC2(CC1(C)C)OC(C)C(C)O2)CC |
| InChI | InChI=1S/C28H48O5Si/c1-11-24(18-25(29)30-12-2)16-17-28(33-34(13-3,14-4)15-5)21(6)19-27(20-26(28,9)10)31-22(7)23(8)32-27/h16-19,22-23H,11-15,20H2,1-10H3/b17-16+,24-18- |
| InChIKey | QQMOPWDXNDJGMP-KHIGFXQNSA-N |
| XLogP | 7.10 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.77 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|