About 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;ethanol;toluene
2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;ethanol;toluene (PubChem CID 89052221) has the molecular formula C17H26N4O
and a molecular weight of 302.42 g/mol. Its IUPAC name is 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;ethanol;toluene.
Molecular Properties
| Compound Name | 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;ethanol;toluene |
| PubChem CID | 89052221 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;ethanol;toluene |
| SMILES | CC(C)(C#N)/N=N/C(C)(C)C#N.CCO.Cc1ccccc1 |
| InChI | InChI=1S/C8H12N4.C7H8.C2H6O/c1-7(2,5-9)11-12-8(3,4)6-10;1-7-5-3-2-4-6-7;1-2-3/h1-4H3;2-6H,1H3;3H,2H2,1H3/b12-11+;; |
| InChIKey | RPDMYEYWXJGRIH-YHPRVSEPSA-N |
| XLogP | 4.04 |
| TPSA | 92.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;ethanol;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;ethanol;toluene?
The IUPAC name of 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;ethanol;toluene (CID 89052221) is 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;ethanol;toluene.
What is the SMILES notation for 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;ethanol;toluene?
The canonical SMILES for 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;ethanol;toluene is CC(C)(C#N)/N=N/C(C)(C)C#N.CCO.Cc1ccccc1.
What is the InChIKey of 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;ethanol;toluene?
The InChIKey is RPDMYEYWXJGRIH-YHPRVSEPSA-N. The full InChI is InChI=1S/C8H12N4.C7H8.C2H6O/c1-7(2,5-9)11-12-8(3,4)6-10;1-7-5-3-2-4-6-7;1-2-3/h1-4H3;2-6H,1H3;3H,2H2,1H3/b12-11+;;.
What are the key properties of 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;ethanol;toluene?
2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;ethanol;toluene has a molecular weight of 302.42 g/mol, XLogP of 4.04, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;ethanol;toluene is sourced from PubChem (CID 89052221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).