C21H36O3Si — CID 89052382
triethyl-[(8-ethynyl-2,3,7,9,9-pentamethyl-1,4-dioxaspiro[4.5]dec-6-en-8-yl)oxy]silane (PubChem CID 89052382) has the molecular formula C21H36O3Si and a molecular weight of 364.60 g/mol. Its IUPAC name is triethyl-[(8-ethynyl-2,3,7,9,9-pentamethyl-1,4-dioxaspiro[4.5]dec-6-en-8-yl)oxy]silane.
| Compound Name | triethyl-[(8-ethynyl-2,3,7,9,9-pentamethyl-1,4-dioxaspiro[4.5]dec-6-en-8-yl)oxy]silane |
|---|---|
| PubChem CID | 89052382 |
| Molecular Formula | C21H36O3Si |
| Molecular Weight | 364.60 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | triethyl-[(8-ethynyl-2,3,7,9,9-pentamethyl-1,4-dioxaspiro[4.5]dec-6-en-8-yl)oxy]silane |
| SMILES | C#CC1(O[Si](CC)(CC)CC)C(C)=CC2(CC1(C)C)OC(C)C(C)O2 |
| InChI | InChI=1S/C21H36O3Si/c1-10-21(24-25(11-2,12-3)13-4)16(5)14-20(15-19(21,8)9)22-17(6)18(7)23-20/h1,14,17-18H,11-13,15H2,2-9H3 |
| InChIKey | QZLWXMJSYFSQFU-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.60 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|