C18H19N5OS — CID 89052599
[[1-(3-cyano-1-methyl-2-oxoquinolin-4-yl)piperidin-4-yl]amino]methyl thiocyanate (PubChem CID 89052599) has the molecular formula C18H19N5OS and a molecular weight of 353.45 g/mol. Its IUPAC name is [[1-(3-cyano-1-methyl-2-oxoquinolin-4-yl)piperidin-4-yl]amino]methyl thiocyanate.
| Compound Name | [[1-(3-cyano-1-methyl-2-oxoquinolin-4-yl)piperidin-4-yl]amino]methyl thiocyanate |
|---|---|
| PubChem CID | 89052599 |
| Molecular Formula | C18H19N5OS |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | [[1-(3-cyano-1-methyl-2-oxoquinolin-4-yl)piperidin-4-yl]amino]methyl thiocyanate |
| SMILES | Cn1c(=O)c(C#N)c(N2CCC(NCSC#N)CC2)c2ccccc21 |
| InChI | InChI=1S/C18H19N5OS/c1-22-16-5-3-2-4-14(16)17(15(10-19)18(22)24)23-8-6-13(7-9-23)21-12-25-11-20/h2-5,13,21H,6-9,12H2,1H3 |
| InChIKey | NEPKHXBLVPYLES-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 84.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|