4-chloro-3-(cyclohexylamino)-2,5-dimethylbenzoic acid

C15H20ClNO2 — CID 89052632

IUPAC4-chloro-3-(cyclohexylamino)-2,5-dimethylbenzoic acid
SMILESCc1cc(C(=O)O)c(C)c(NC2CCCCC2)c1Cl
InChIInChI=1S/C15H20ClNO2/c1-9-8-12(15(18)19)10(2)14(13(9)16)17-11-6-4-3-5-7-11/h8,11,17H,3-7H2,1-2H3,(H,18,19)
InChIKeyPSPMJZUUUXBAAX-UHFFFAOYSA-N
MW281.78 g/mol
LogP4.40
Rot. Bonds3

About 4-chloro-3-(cyclohexylamino)-2,5-dimethylbenzoic acid

4-chloro-3-(cyclohexylamino)-2,5-dimethylbenzoic acid (PubChem CID 89052632) has the molecular formula C15H20ClNO2 and a molecular weight of 281.78 g/mol. Its IUPAC name is 4-chloro-3-(cyclohexylamino)-2,5-dimethylbenzoic acid.

Molecular Properties

Compound Name4-chloro-3-(cyclohexylamino)-2,5-dimethylbenzoic acid
PubChem CID89052632
Molecular FormulaC15H20ClNO2
Molecular Weight281.78 g/mol
Exact Mass281.12
IUPAC Name4-chloro-3-(cyclohexylamino)-2,5-dimethylbenzoic acid
SMILESCc1cc(C(=O)O)c(C)c(NC2CCCCC2)c1Cl
InChIInChI=1S/C15H20ClNO2/c1-9-8-12(15(18)19)10(2)14(13(9)16)17-11-6-4-3-5-7-11/h8,11,17H,3-7H2,1-2H3,(H,18,19)
InChIKeyPSPMJZUUUXBAAX-UHFFFAOYSA-N
XLogP4.40
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.78
LogP ≤ 54.40
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 4-chloro-3-(cyclohexylamino)-2,5-dimethylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-chloro-3-(cyclohexylamino)-2,5-dimethylbenzoic acid?
The IUPAC name of 4-chloro-3-(cyclohexylamino)-2,5-dimethylbenzoic acid (CID 89052632) is 4-chloro-3-(cyclohexylamino)-2,5-dimethylbenzoic acid.
What is the SMILES notation for 4-chloro-3-(cyclohexylamino)-2,5-dimethylbenzoic acid?
The canonical SMILES for 4-chloro-3-(cyclohexylamino)-2,5-dimethylbenzoic acid is Cc1cc(C(=O)O)c(C)c(NC2CCCCC2)c1Cl.
What is the InChIKey of 4-chloro-3-(cyclohexylamino)-2,5-dimethylbenzoic acid?
The InChIKey is PSPMJZUUUXBAAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20ClNO2/c1-9-8-12(15(18)19)10(2)14(13(9)16)17-11-6-4-3-5-7-11/h8,11,17H,3-7H2,1-2H3,(H,18,19).
What are the key properties of 4-chloro-3-(cyclohexylamino)-2,5-dimethylbenzoic acid?
4-chloro-3-(cyclohexylamino)-2,5-dimethylbenzoic acid has a molecular weight of 281.78 g/mol, XLogP of 4.40, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-(cyclohexylamino)-2,5-dimethylbenzoic acid is sourced from PubChem (CID 89052632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).