C35H34F6O4S — CID 89053069
4-[1,1,1,3,3,3-hexafluoro-2-[4-[2-[4-[4-(2-methylbutan-2-yl)phenyl]sulfonylphenyl]propan-2-yloxy]phenyl]propan-2-yl]phenol (PubChem CID 89053069) has the molecular formula C35H34F6O4S and a molecular weight of 664.71 g/mol. Its IUPAC name is 4-[1,1,1,3,3,3-hexafluoro-2-[4-[2-[4-[4-(2-methylbutan-2-yl)phenyl]sulfonylphenyl]propan-2-yloxy]phenyl]propan-2-yl]phenol.
| Compound Name | 4-[1,1,1,3,3,3-hexafluoro-2-[4-[2-[4-[4-(2-methylbutan-2-yl)phenyl]sulfonylphenyl]propan-2-yloxy]phenyl]propan-2-yl]phenol |
|---|---|
| PubChem CID | 89053069 |
| Molecular Formula | C35H34F6O4S |
| Molecular Weight | 664.71 g/mol |
| Exact Mass | 664.21 |
| IUPAC Name | 4-[1,1,1,3,3,3-hexafluoro-2-[4-[2-[4-[4-(2-methylbutan-2-yl)phenyl]sulfonylphenyl]propan-2-yloxy]phenyl]propan-2-yl]phenol |
| SMILES | CCC(C)(C)c1ccc(S(=O)(=O)c2ccc(C(C)(C)Oc3ccc(C(c4ccc(O)cc4)(C(F)(F)F)C(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C35H34F6O4S/c1-6-31(2,3)23-11-19-29(20-12-23)46(43,44)30-21-13-24(14-22-30)32(4,5)45-28-17-9-26(10-18-28)33(34(36,37)38,35(39,40)41)25-7-15-27(42)16-8-25/h7-22,42H,6H2,1-5H3 |
| InChIKey | ZVRZXETXZKUCOU-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.71 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |